C17H31NO2S — CID 66421781
2-[4-(4-tert-butylcycloheptyl)thiomorpholin-3-yl]acetic acid (PubChem CID 66421781) has the molecular formula C17H31NO2S and a molecular weight of 313.51 g/mol. Its IUPAC name is 2-[4-(4-tert-butylcycloheptyl)thiomorpholin-3-yl]acetic acid.
| Compound Name | 2-[4-(4-tert-butylcycloheptyl)thiomorpholin-3-yl]acetic acid |
|---|---|
| PubChem CID | 66421781 |
| Molecular Formula | C17H31NO2S |
| Molecular Weight | 313.51 g/mol |
| Exact Mass | 313.21 |
| IUPAC Name | 2-[4-(4-tert-butylcycloheptyl)thiomorpholin-3-yl]acetic acid |
| SMILES | CC(C)(C)C1CCCC(N2CCSCC2CC(=O)O)CC1 |
| InChI | InChI=1S/C17H31NO2S/c1-17(2,3)13-5-4-6-14(8-7-13)18-9-10-21-12-15(18)11-16(19)20/h13-15H,4-12H2,1-3H3,(H,19,20) |
| InChIKey | XYURPZRRTKMIKY-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.51 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |