C10H19NO4S2 — CID 66445474
2-(4-tert-butylsulfonylthiomorpholin-3-yl)acetic acid (PubChem CID 66445474) has the molecular formula C10H19NO4S2 and a molecular weight of 281.40 g/mol. Its IUPAC name is 2-(4-tert-butylsulfonylthiomorpholin-3-yl)acetic acid.
| Compound Name | 2-(4-tert-butylsulfonylthiomorpholin-3-yl)acetic acid |
|---|---|
| PubChem CID | 66445474 |
| Molecular Formula | C10H19NO4S2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 2-(4-tert-butylsulfonylthiomorpholin-3-yl)acetic acid |
| SMILES | CC(C)(C)S(=O)(=O)N1CCSCC1CC(=O)O |
| InChI | InChI=1S/C10H19NO4S2/c1-10(2,3)17(14,15)11-4-5-16-7-8(11)6-9(12)13/h8H,4-7H2,1-3H3,(H,12,13) |
| InChIKey | BLLRCSJSRMROAN-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |