C12H13Cl2NO4S2 — CID 66443515
2-[4-(2,6-dichlorophenyl)sulfonylthiomorpholin-3-yl]acetic acid (PubChem CID 66443515) has the molecular formula C12H13Cl2NO4S2 and a molecular weight of 370.28 g/mol. Its IUPAC name is 2-[4-(2,6-dichlorophenyl)sulfonylthiomorpholin-3-yl]acetic acid.
| Compound Name | 2-[4-(2,6-dichlorophenyl)sulfonylthiomorpholin-3-yl]acetic acid |
|---|---|
| PubChem CID | 66443515 |
| Molecular Formula | C12H13Cl2NO4S2 |
| Molecular Weight | 370.28 g/mol |
| Exact Mass | 368.97 |
| IUPAC Name | 2-[4-(2,6-dichlorophenyl)sulfonylthiomorpholin-3-yl]acetic acid |
| SMILES | O=C(O)CC1CSCCN1S(=O)(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H13Cl2NO4S2/c13-9-2-1-3-10(14)12(9)21(18,19)15-4-5-20-7-8(15)6-11(16)17/h1-3,8H,4-7H2,(H,16,17) |
| InChIKey | ISKOKQJHEUDBQM-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.28 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |