C6H12N2O4S2 — CID 114958951
2-(4-sulfamoylthiomorpholin-3-yl)acetic acid (PubChem CID 114958951) has the molecular formula C6H12N2O4S2 and a molecular weight of 240.31 g/mol. Its IUPAC name is 2-(4-sulfamoylthiomorpholin-3-yl)acetic acid.
| Compound Name | 2-(4-sulfamoylthiomorpholin-3-yl)acetic acid |
|---|---|
| PubChem CID | 114958951 |
| Molecular Formula | C6H12N2O4S2 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | 2-(4-sulfamoylthiomorpholin-3-yl)acetic acid |
| SMILES | NS(=O)(=O)N1CCSCC1CC(=O)O |
| InChI | InChI=1S/C6H12N2O4S2/c7-14(11,12)8-1-2-13-4-5(8)3-6(9)10/h5H,1-4H2,(H,9,10)(H2,7,11,12) |
| InChIKey | IRPCJBWBTUNZFB-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |