C10H19NO5S2 — CID 66445470
2-[4-(3-methoxypropylsulfonyl)thiomorpholin-3-yl]acetic acid (PubChem CID 66445470) has the molecular formula C10H19NO5S2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 2-[4-(3-methoxypropylsulfonyl)thiomorpholin-3-yl]acetic acid.
| Compound Name | 2-[4-(3-methoxypropylsulfonyl)thiomorpholin-3-yl]acetic acid |
|---|---|
| PubChem CID | 66445470 |
| Molecular Formula | C10H19NO5S2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 2-[4-(3-methoxypropylsulfonyl)thiomorpholin-3-yl]acetic acid |
| SMILES | COCCCS(=O)(=O)N1CCSCC1CC(=O)O |
| InChI | InChI=1S/C10H19NO5S2/c1-16-4-2-6-18(14,15)11-3-5-17-8-9(11)7-10(12)13/h9H,2-8H2,1H3,(H,12,13) |
| InChIKey | WPCRNIQIPHHYHH-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|