C10H18N2O3S2 — CID 66422198
N-(1,1-dioxothiolan-3-yl)-2-thiomorpholin-3-ylacetamide (PubChem CID 66422198) has the molecular formula C10H18N2O3S2 and a molecular weight of 278.40 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 66422198 |
| Molecular Formula | C10H18N2O3S2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-thiomorpholin-3-ylacetamide |
| SMILES | O=C(CC1CSCCN1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H18N2O3S2/c13-10(5-9-6-16-3-2-11-9)12-8-1-4-17(14,15)7-8/h8-9,11H,1-7H2,(H,12,13) |
| InChIKey | TZZRMPYLHXPJJD-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |