C12H10FN5O — CID 66425508
3-(4-amino-6-ethoxy-1,3,5-triazin-2-yl)-5-fluorobenzonitrile (PubChem CID 66425508) has the molecular formula C12H10FN5O and a molecular weight of 259.24 g/mol. Its IUPAC name is 3-(4-amino-6-ethoxy-1,3,5-triazin-2-yl)-5-fluorobenzonitrile.
| Compound Name | 3-(4-amino-6-ethoxy-1,3,5-triazin-2-yl)-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 66425508 |
| Molecular Formula | C12H10FN5O |
| Molecular Weight | 259.24 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 3-(4-amino-6-ethoxy-1,3,5-triazin-2-yl)-5-fluorobenzonitrile |
| SMILES | CCOc1nc(N)nc(-c2cc(F)cc(C#N)c2)n1 |
| InChI | InChI=1S/C12H10FN5O/c1-2-19-12-17-10(16-11(15)18-12)8-3-7(6-14)4-9(13)5-8/h3-5H,2H2,1H3,(H2,15,16,17,18) |
| InChIKey | IAZMGIYLRHLPNS-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.24 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |