C10H12N6O2 — CID 113421721
4-ethoxy-6-(3-methoxypyrazin-2-yl)-1,3,5-triazin-2-amine (PubChem CID 113421721) has the molecular formula C10H12N6O2 and a molecular weight of 248.25 g/mol. Its IUPAC name is 4-ethoxy-6-(3-methoxypyrazin-2-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4-ethoxy-6-(3-methoxypyrazin-2-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 113421721 |
| Molecular Formula | C10H12N6O2 |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 4-ethoxy-6-(3-methoxypyrazin-2-yl)-1,3,5-triazin-2-amine |
| SMILES | CCOc1nc(N)nc(-c2nccnc2OC)n1 |
| InChI | InChI=1S/C10H12N6O2/c1-3-18-10-15-7(14-9(11)16-10)6-8(17-2)13-5-4-12-6/h4-5H,3H2,1-2H3,(H2,11,14,15,16) |
| InChIKey | XJIQWKYFYUZEDC-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 108.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |