C9H11N5OS — CID 79820066
4-ethoxy-6-(1,3-thiazol-2-ylmethyl)-1,3,5-triazin-2-amine (PubChem CID 79820066) has the molecular formula C9H11N5OS and a molecular weight of 237.29 g/mol. Its IUPAC name is 4-ethoxy-6-(1,3-thiazol-2-ylmethyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-ethoxy-6-(1,3-thiazol-2-ylmethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 79820066 |
| Molecular Formula | C9H11N5OS |
| Molecular Weight | 237.29 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 4-ethoxy-6-(1,3-thiazol-2-ylmethyl)-1,3,5-triazin-2-amine |
| SMILES | CCOc1nc(N)nc(Cc2nccs2)n1 |
| InChI | InChI=1S/C9H11N5OS/c1-2-15-9-13-6(12-8(10)14-9)5-7-11-3-4-16-7/h3-4H,2,5H2,1H3,(H2,10,12,13,14) |
| InChIKey | NIJHYNZSPXXWKE-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 86.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.29 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |