C10H23N3O2 — CID 66427989
4-amino-3-[ethyl(2-methoxyethyl)amino]-N-methylbutanamide (PubChem CID 66427989) has the molecular formula C10H23N3O2 and a molecular weight of 217.31 g/mol. Its IUPAC name is 4-amino-3-[ethyl(2-methoxyethyl)amino]-N-methylbutanamide.
| Compound Name | 4-amino-3-[ethyl(2-methoxyethyl)amino]-N-methylbutanamide |
|---|---|
| PubChem CID | 66427989 |
| Molecular Formula | C10H23N3O2 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 4-amino-3-[ethyl(2-methoxyethyl)amino]-N-methylbutanamide |
| SMILES | CCN(CCOC)C(CN)CC(=O)NC |
| InChI | InChI=1S/C10H23N3O2/c1-4-13(5-6-15-3)9(8-11)7-10(14)12-2/h9H,4-8,11H2,1-3H3,(H,12,14) |
| InChIKey | WYNJKORJNNSVHP-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |