C14H28N2O5 — CID 169107909
tert-butyl N-(2-methoxyethyl)-N-[1-methoxy-4-(methylamino)-4-oxobutan-2-yl]carbamate (PubChem CID 169107909) has the molecular formula C14H28N2O5 and a molecular weight of 304.39 g/mol. Its IUPAC name is tert-butyl N-(2-methoxyethyl)-N-[1-methoxy-4-(methylamino)-4-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-(2-methoxyethyl)-N-[1-methoxy-4-(methylamino)-4-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 169107909 |
| Molecular Formula | C14H28N2O5 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | tert-butyl N-(2-methoxyethyl)-N-[1-methoxy-4-(methylamino)-4-oxobutan-2-yl]carbamate |
| SMILES | CNC(=O)CC(COC)N(CCOC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H28N2O5/c1-14(2,3)21-13(18)16(7-8-19-5)11(10-20-6)9-12(17)15-4/h11H,7-10H2,1-6H3,(H,15,17) |
| InChIKey | YMCJNDHADANFGE-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |