C12H8F2O3S — CID 66437978
4-[(2,4-difluorophenyl)methoxy]thiophene-2-carboxylic acid (PubChem CID 66437978) has the molecular formula C12H8F2O3S and a molecular weight of 270.26 g/mol. Its IUPAC name is 4-[(2,4-difluorophenyl)methoxy]thiophene-2-carboxylic acid.
| Compound Name | 4-[(2,4-difluorophenyl)methoxy]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 66437978 |
| Molecular Formula | C12H8F2O3S |
| Molecular Weight | 270.26 g/mol |
| Exact Mass | 270.02 |
| IUPAC Name | 4-[(2,4-difluorophenyl)methoxy]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1cc(OCc2ccc(F)cc2F)cs1 |
| InChI | InChI=1S/C12H8F2O3S/c13-8-2-1-7(10(14)3-8)5-17-9-4-11(12(15)16)18-6-9/h1-4,6H,5H2,(H,15,16) |
| InChIKey | XHIHPLKXGNKJRJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.26 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |