C14H9NO5S — CID 66438194
4-[(1,3-dioxoisoindol-2-yl)methoxy]thiophene-2-carboxylic acid (PubChem CID 66438194) has the molecular formula C14H9NO5S and a molecular weight of 303.30 g/mol. Its IUPAC name is 4-[(1,3-dioxoisoindol-2-yl)methoxy]thiophene-2-carboxylic acid.
| Compound Name | 4-[(1,3-dioxoisoindol-2-yl)methoxy]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 66438194 |
| Molecular Formula | C14H9NO5S |
| Molecular Weight | 303.30 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | 4-[(1,3-dioxoisoindol-2-yl)methoxy]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1cc(OCN2C(=O)c3ccccc3C2=O)cs1 |
| InChI | InChI=1S/C14H9NO5S/c16-12-9-3-1-2-4-10(9)13(17)15(12)7-20-8-5-11(14(18)19)21-6-8/h1-6H,7H2,(H,18,19) |
| InChIKey | VWJODHOOZYNAOA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.30 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|