C11H19F2N3 — CID 66441934
N-[[5-(difluoromethyl)-1-ethylpyrazol-4-yl]methyl]-2-methylpropan-2-amine (PubChem CID 66441934) has the molecular formula C11H19F2N3 and a molecular weight of 231.29 g/mol. Its IUPAC name is N-[[5-(difluoromethyl)-1-ethylpyrazol-4-yl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[5-(difluoromethyl)-1-ethylpyrazol-4-yl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 66441934 |
| Molecular Formula | C11H19F2N3 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | N-[[5-(difluoromethyl)-1-ethylpyrazol-4-yl]methyl]-2-methylpropan-2-amine |
| SMILES | CCn1ncc(CNC(C)(C)C)c1C(F)F |
| InChI | InChI=1S/C11H19F2N3/c1-5-16-9(10(12)13)8(7-15-16)6-14-11(2,3)4/h7,10,14H,5-6H2,1-4H3 |
| InChIKey | PJWGBLGSOKNKBN-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |