C14H16ClF2N3 — CID 66442604
N-[[1-[(2-chlorophenyl)methyl]-5-(difluoromethyl)pyrazol-4-yl]methyl]ethanamine (PubChem CID 66442604) has the molecular formula C14H16ClF2N3 and a molecular weight of 299.75 g/mol. Its IUPAC name is N-[[1-[(2-chlorophenyl)methyl]-5-(difluoromethyl)pyrazol-4-yl]methyl]ethanamine.
| Compound Name | N-[[1-[(2-chlorophenyl)methyl]-5-(difluoromethyl)pyrazol-4-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 66442604 |
| Molecular Formula | C14H16ClF2N3 |
| Molecular Weight | 299.75 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | N-[[1-[(2-chlorophenyl)methyl]-5-(difluoromethyl)pyrazol-4-yl]methyl]ethanamine |
| SMILES | CCNCc1cnn(Cc2ccccc2Cl)c1C(F)F |
| InChI | InChI=1S/C14H16ClF2N3/c1-2-18-7-11-8-19-20(13(11)14(16)17)9-10-5-3-4-6-12(10)15/h3-6,8,14,18H,2,7,9H2,1H3 |
| InChIKey | IFVKOJBKEPDODX-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.75 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |