C15H16Cl2N2 — CID 66447752
1-(2,4-dichlorophenyl)-N-methyl-2-pyridin-4-ylpropan-1-amine (PubChem CID 66447752) has the molecular formula C15H16Cl2N2 and a molecular weight of 295.21 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-N-methyl-2-pyridin-4-ylpropan-1-amine.
| Compound Name | 1-(2,4-dichlorophenyl)-N-methyl-2-pyridin-4-ylpropan-1-amine |
|---|---|
| PubChem CID | 66447752 |
| Molecular Formula | C15H16Cl2N2 |
| Molecular Weight | 295.21 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-N-methyl-2-pyridin-4-ylpropan-1-amine |
| SMILES | CNC(c1ccc(Cl)cc1Cl)C(C)c1ccncc1 |
| InChI | InChI=1S/C15H16Cl2N2/c1-10(11-5-7-19-8-6-11)15(18-2)13-4-3-12(16)9-14(13)17/h3-10,15,18H,1-2H3 |
| InChIKey | VHYUWIRCSMRVBP-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.21 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |