C17H20Cl2N2 — CID 66448152
1-(2,6-dichlorophenyl)-N-propyl-2-pyridin-4-ylpropan-1-amine (PubChem CID 66448152) has the molecular formula C17H20Cl2N2 and a molecular weight of 323.27 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-N-propyl-2-pyridin-4-ylpropan-1-amine.
| Compound Name | 1-(2,6-dichlorophenyl)-N-propyl-2-pyridin-4-ylpropan-1-amine |
|---|---|
| PubChem CID | 66448152 |
| Molecular Formula | C17H20Cl2N2 |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-N-propyl-2-pyridin-4-ylpropan-1-amine |
| SMILES | CCCNC(c1c(Cl)cccc1Cl)C(C)c1ccncc1 |
| InChI | InChI=1S/C17H20Cl2N2/c1-3-9-21-17(12(2)13-7-10-20-11-8-13)16-14(18)5-4-6-15(16)19/h4-8,10-12,17,21H,3,9H2,1-2H3 |
| InChIKey | ZNTXLVCTYHUCFY-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |