C15H19IN2S — CID 79692893
1-(5-iodothiophen-3-yl)-N-propyl-2-pyridin-4-ylpropan-1-amine (PubChem CID 79692893) has the molecular formula C15H19IN2S and a molecular weight of 386.30 g/mol. Its IUPAC name is 1-(5-iodothiophen-3-yl)-N-propyl-2-pyridin-4-ylpropan-1-amine.
| Compound Name | 1-(5-iodothiophen-3-yl)-N-propyl-2-pyridin-4-ylpropan-1-amine |
|---|---|
| PubChem CID | 79692893 |
| Molecular Formula | C15H19IN2S |
| Molecular Weight | 386.30 g/mol |
| Exact Mass | 386.03 |
| IUPAC Name | 1-(5-iodothiophen-3-yl)-N-propyl-2-pyridin-4-ylpropan-1-amine |
| SMILES | CCCNC(c1csc(I)c1)C(C)c1ccncc1 |
| InChI | InChI=1S/C15H19IN2S/c1-3-6-18-15(13-9-14(16)19-10-13)11(2)12-4-7-17-8-5-12/h4-5,7-11,15,18H,3,6H2,1-2H3 |
| InChIKey | BSDJRHRVDLKMRA-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.30 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|