C13H18IN3S — CID 79684646
N-[(1-ethylimidazol-2-yl)-(5-iodothiophen-3-yl)methyl]propan-1-amine (PubChem CID 79684646) has the molecular formula C13H18IN3S and a molecular weight of 375.28 g/mol. Its IUPAC name is N-[(1-ethylimidazol-2-yl)-(5-iodothiophen-3-yl)methyl]propan-1-amine.
| Compound Name | N-[(1-ethylimidazol-2-yl)-(5-iodothiophen-3-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 79684646 |
| Molecular Formula | C13H18IN3S |
| Molecular Weight | 375.28 g/mol |
| Exact Mass | 375.03 |
| IUPAC Name | N-[(1-ethylimidazol-2-yl)-(5-iodothiophen-3-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1csc(I)c1)c1nccn1CC |
| InChI | InChI=1S/C13H18IN3S/c1-3-5-15-12(10-8-11(14)18-9-10)13-16-6-7-17(13)4-2/h6-9,12,15H,3-5H2,1-2H3 |
| InChIKey | GSDOXRYZOKCWSF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.28 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|