C11H9Cl2N3O — CID 66451005
[6-(2,5-dichlorophenoxy)pyrazin-2-yl]methanamine (PubChem CID 66451005) has the molecular formula C11H9Cl2N3O and a molecular weight of 270.12 g/mol. Its IUPAC name is [6-(2,5-dichlorophenoxy)pyrazin-2-yl]methanamine.
| Compound Name | [6-(2,5-dichlorophenoxy)pyrazin-2-yl]methanamine |
|---|---|
| PubChem CID | 66451005 |
| Molecular Formula | C11H9Cl2N3O |
| Molecular Weight | 270.12 g/mol |
| Exact Mass | 269.01 |
| IUPAC Name | [6-(2,5-dichlorophenoxy)pyrazin-2-yl]methanamine |
| SMILES | NCc1cncc(Oc2cc(Cl)ccc2Cl)n1 |
| InChI | InChI=1S/C11H9Cl2N3O/c12-7-1-2-9(13)10(3-7)17-11-6-15-5-8(4-14)16-11/h1-3,5-6H,4,14H2 |
| InChIKey | HTEYQPDPBXWSTO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.12 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |