C13H10Cl3NO — CID 113378896
4-(chloromethyl)-2-(2,5-dichlorophenoxy)-6-methylpyridine (PubChem CID 113378896) has the molecular formula C13H10Cl3NO and a molecular weight of 302.59 g/mol. Its IUPAC name is 4-(chloromethyl)-2-(2,5-dichlorophenoxy)-6-methylpyridine.
| Compound Name | 4-(chloromethyl)-2-(2,5-dichlorophenoxy)-6-methylpyridine |
|---|---|
| PubChem CID | 113378896 |
| Molecular Formula | C13H10Cl3NO |
| Molecular Weight | 302.59 g/mol |
| Exact Mass | 300.98 |
| IUPAC Name | 4-(chloromethyl)-2-(2,5-dichlorophenoxy)-6-methylpyridine |
| SMILES | Cc1cc(CCl)cc(Oc2cc(Cl)ccc2Cl)n1 |
| InChI | InChI=1S/C13H10Cl3NO/c1-8-4-9(7-14)5-13(17-8)18-12-6-10(15)2-3-11(12)16/h2-6H,7H2,1H3 |
| InChIKey | JACWBJFQMDQNTO-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.59 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|