C16H17NO2S — CID 66460663
1-(1,3-benzoxazol-2-yl)-5-thiophen-2-ylpentan-2-ol (PubChem CID 66460663) has the molecular formula C16H17NO2S and a molecular weight of 287.38 g/mol. Its IUPAC name is 1-(1,3-benzoxazol-2-yl)-5-thiophen-2-ylpentan-2-ol.
| Compound Name | 1-(1,3-benzoxazol-2-yl)-5-thiophen-2-ylpentan-2-ol |
|---|---|
| PubChem CID | 66460663 |
| Molecular Formula | C16H17NO2S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 1-(1,3-benzoxazol-2-yl)-5-thiophen-2-ylpentan-2-ol |
| SMILES | OC(CCCc1cccs1)Cc1nc2ccccc2o1 |
| InChI | InChI=1S/C16H17NO2S/c18-12(5-3-6-13-7-4-10-20-13)11-16-17-14-8-1-2-9-15(14)19-16/h1-2,4,7-10,12,18H,3,5-6,11H2 |
| InChIKey | QNFDVYGPNLOSBG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |