C14H13NO2S — CID 66461865
2-(1,3-benzoxazol-2-yl)-1-(3-methylthiophen-2-yl)ethanol (PubChem CID 66461865) has the molecular formula C14H13NO2S and a molecular weight of 259.33 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-yl)-1-(3-methylthiophen-2-yl)ethanol.
| Compound Name | 2-(1,3-benzoxazol-2-yl)-1-(3-methylthiophen-2-yl)ethanol |
|---|---|
| PubChem CID | 66461865 |
| Molecular Formula | C14H13NO2S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 2-(1,3-benzoxazol-2-yl)-1-(3-methylthiophen-2-yl)ethanol |
| SMILES | Cc1ccsc1C(O)Cc1nc2ccccc2o1 |
| InChI | InChI=1S/C14H13NO2S/c1-9-6-7-18-14(9)11(16)8-13-15-10-4-2-3-5-12(10)17-13/h2-7,11,16H,8H2,1H3 |
| InChIKey | DRFAIPGHBJSRSL-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |