About 3-[2-(1,3-dioxan-2-yl)ethyl]pyrimidin-4-one
3-[2-(1,3-dioxan-2-yl)ethyl]pyrimidin-4-one (PubChem CID 66472540) has the molecular formula C10H14N2O3
and a molecular weight of 210.23 g/mol. Its IUPAC name is 3-[2-(1,3-dioxan-2-yl)ethyl]pyrimidin-4-one.
Molecular Properties
| Compound Name | 3-[2-(1,3-dioxan-2-yl)ethyl]pyrimidin-4-one |
| PubChem CID | 66472540 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 3-[2-(1,3-dioxan-2-yl)ethyl]pyrimidin-4-one |
| SMILES | O=c1ccncn1CCC1OCCCO1 |
| InChI | InChI=1S/C10H14N2O3/c13-9-2-4-11-8-12(9)5-3-10-14-6-1-7-15-10/h2,4,8,10H,1,3,5-7H2 |
| InChIKey | SPPOYGYKEHXUOR-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[2-(1,3-dioxan-2-yl)ethyl]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(1,3-dioxan-2-yl)ethyl]pyrimidin-4-one?
The IUPAC name of 3-[2-(1,3-dioxan-2-yl)ethyl]pyrimidin-4-one (CID 66472540) is 3-[2-(1,3-dioxan-2-yl)ethyl]pyrimidin-4-one.
What is the SMILES notation for 3-[2-(1,3-dioxan-2-yl)ethyl]pyrimidin-4-one?
The canonical SMILES for 3-[2-(1,3-dioxan-2-yl)ethyl]pyrimidin-4-one is O=c1ccncn1CCC1OCCCO1.
What is the InChIKey of 3-[2-(1,3-dioxan-2-yl)ethyl]pyrimidin-4-one?
The InChIKey is SPPOYGYKEHXUOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O3/c13-9-2-4-11-8-12(9)5-3-10-14-6-1-7-15-10/h2,4,8,10H,1,3,5-7H2.
What are the key properties of 3-[2-(1,3-dioxan-2-yl)ethyl]pyrimidin-4-one?
3-[2-(1,3-dioxan-2-yl)ethyl]pyrimidin-4-one has a molecular weight of 210.23 g/mol, XLogP of 0.40, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(1,3-dioxan-2-yl)ethyl]pyrimidin-4-one is sourced from PubChem (CID 66472540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).