About 4-[2-(1,3-dioxan-2-yl)ethoxy]-3-iodo-5-nitrobenzonitrile
4-[2-(1,3-dioxan-2-yl)ethoxy]-3-iodo-5-nitrobenzonitrile (PubChem CID 66472748) has the molecular formula C13H13IN2O5
and a molecular weight of 404.16 g/mol. Its IUPAC name is 4-[2-(1,3-dioxan-2-yl)ethoxy]-3-iodo-5-nitrobenzonitrile.
Molecular Properties
| Compound Name | 4-[2-(1,3-dioxan-2-yl)ethoxy]-3-iodo-5-nitrobenzonitrile |
| PubChem CID | 66472748 |
| Molecular Formula | C13H13IN2O5 |
| Molecular Weight | 404.16 g/mol |
| Exact Mass | 403.99 |
| IUPAC Name | 4-[2-(1,3-dioxan-2-yl)ethoxy]-3-iodo-5-nitrobenzonitrile |
| SMILES | N#Cc1cc(I)c(OCCC2OCCCO2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H13IN2O5/c14-10-6-9(8-15)7-11(16(17)18)13(10)21-5-2-12-19-3-1-4-20-12/h6-7,12H,1-5H2 |
| InChIKey | NXUHNJQAZONCSO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 94.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.16 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(1,3-dioxan-2-yl)ethoxy]-3-iodo-5-nitrobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(1,3-dioxan-2-yl)ethoxy]-3-iodo-5-nitrobenzonitrile?
The IUPAC name of 4-[2-(1,3-dioxan-2-yl)ethoxy]-3-iodo-5-nitrobenzonitrile (CID 66472748) is 4-[2-(1,3-dioxan-2-yl)ethoxy]-3-iodo-5-nitrobenzonitrile.
What is the SMILES notation for 4-[2-(1,3-dioxan-2-yl)ethoxy]-3-iodo-5-nitrobenzonitrile?
The canonical SMILES for 4-[2-(1,3-dioxan-2-yl)ethoxy]-3-iodo-5-nitrobenzonitrile is N#Cc1cc(I)c(OCCC2OCCCO2)c([N+](=O)[O-])c1.
What is the InChIKey of 4-[2-(1,3-dioxan-2-yl)ethoxy]-3-iodo-5-nitrobenzonitrile?
The InChIKey is NXUHNJQAZONCSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13IN2O5/c14-10-6-9(8-15)7-11(16(17)18)13(10)21-5-2-12-19-3-1-4-20-12/h6-7,12H,1-5H2.
What are the key properties of 4-[2-(1,3-dioxan-2-yl)ethoxy]-3-iodo-5-nitrobenzonitrile?
4-[2-(1,3-dioxan-2-yl)ethoxy]-3-iodo-5-nitrobenzonitrile has a molecular weight of 404.16 g/mol, XLogP of 2.60, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(1,3-dioxan-2-yl)ethoxy]-3-iodo-5-nitrobenzonitrile is sourced from PubChem (CID 66472748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).