C12H15IO3 — CID 66472751
2-[2-(4-iodophenoxy)ethyl]-1,3-dioxane (PubChem CID 66472751) has the molecular formula C12H15IO3 and a molecular weight of 334.15 g/mol. Its IUPAC name is 2-[2-(4-iodophenoxy)ethyl]-1,3-dioxane.
| Compound Name | 2-[2-(4-iodophenoxy)ethyl]-1,3-dioxane |
|---|---|
| PubChem CID | 66472751 |
| Molecular Formula | C12H15IO3 |
| Molecular Weight | 334.15 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | 2-[2-(4-iodophenoxy)ethyl]-1,3-dioxane |
| SMILES | Ic1ccc(OCCC2OCCCO2)cc1 |
| InChI | InChI=1S/C12H15IO3/c13-10-2-4-11(5-3-10)14-9-6-12-15-7-1-8-16-12/h2-5,12H,1,6-9H2 |
| InChIKey | ZICNKKHLYCJNMK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.15 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|