C13H16F3N5 — CID 66475670
N-[[1-[2-methyl-5-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl]propan-2-amine (PubChem CID 66475670) has the molecular formula C13H16F3N5 and a molecular weight of 299.30 g/mol. Its IUPAC name is N-[[1-[2-methyl-5-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl]propan-2-amine.
| Compound Name | N-[[1-[2-methyl-5-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 66475670 |
| Molecular Formula | C13H16F3N5 |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | N-[[1-[2-methyl-5-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl]propan-2-amine |
| SMILES | Cc1ccc(C(F)(F)F)cc1-n1nnnc1CNC(C)C |
| InChI | InChI=1S/C13H16F3N5/c1-8(2)17-7-12-18-19-20-21(12)11-6-10(13(14,15)16)5-4-9(11)3/h4-6,8,17H,7H2,1-3H3 |
| InChIKey | CGBZTAKDKKMDFW-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |