C16H21ClO — CID 66477542
5-[chloro-(2,2,3,3-tetramethylcyclopropyl)methyl]-1,3-dihydro-2-benzofuran (PubChem CID 66477542) has the molecular formula C16H21ClO and a molecular weight of 264.80 g/mol. Its IUPAC name is 5-[chloro-(2,2,3,3-tetramethylcyclopropyl)methyl]-1,3-dihydro-2-benzofuran.
| Compound Name | 5-[chloro-(2,2,3,3-tetramethylcyclopropyl)methyl]-1,3-dihydro-2-benzofuran |
|---|---|
| PubChem CID | 66477542 |
| Molecular Formula | C16H21ClO |
| Molecular Weight | 264.80 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 5-[chloro-(2,2,3,3-tetramethylcyclopropyl)methyl]-1,3-dihydro-2-benzofuran |
| SMILES | CC1(C)C(C(Cl)c2ccc3c(c2)COC3)C1(C)C |
| InChI | InChI=1S/C16H21ClO/c1-15(2)14(16(15,3)4)13(17)10-5-6-11-8-18-9-12(11)7-10/h5-7,13-14H,8-9H2,1-4H3 |
| InChIKey | YUPRSQWWUZOONR-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.80 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|