C14H14Cl2N2 — CID 66489571
4-chloro-6-(3-chlorophenyl)-3-methyl-4,5,6,7-tetrahydro-2H-indazole (PubChem CID 66489571) has the molecular formula C14H14Cl2N2 and a molecular weight of 281.19 g/mol. Its IUPAC name is 4-chloro-6-(3-chlorophenyl)-3-methyl-4,5,6,7-tetrahydro-2H-indazole.
| Compound Name | 4-chloro-6-(3-chlorophenyl)-3-methyl-4,5,6,7-tetrahydro-2H-indazole |
|---|---|
| PubChem CID | 66489571 |
| Molecular Formula | C14H14Cl2N2 |
| Molecular Weight | 281.19 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 4-chloro-6-(3-chlorophenyl)-3-methyl-4,5,6,7-tetrahydro-2H-indazole |
| SMILES | Cc1[nH]nc2c1C(Cl)CC(c1cccc(Cl)c1)C2 |
| InChI | InChI=1S/C14H14Cl2N2/c1-8-14-12(16)6-10(7-13(14)18-17-8)9-3-2-4-11(15)5-9/h2-5,10,12H,6-7H2,1H3,(H,17,18) |
| InChIKey | LZUKNUGCDLPMET-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.19 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|