C21H20N4O3S — CID 66491183
2-[4-(3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)phenyl]-N-(5-methyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 66491183) has the molecular formula C21H20N4O3S and a molecular weight of 408.48 g/mol. Its IUPAC name is 2-[4-(3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)phenyl]-N-(5-methyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-[4-(3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)phenyl]-N-(5-methyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 66491183 |
| Molecular Formula | C21H20N4O3S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 2-[4-(3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)phenyl]-N-(5-methyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | Cc1nnc(NC(=O)Cc2ccc(N3C(=O)C4C5C=CC(CC5)C4C3=O)cc2)s1 |
| InChI | InChI=1S/C21H20N4O3S/c1-11-23-24-21(29-11)22-16(26)10-12-2-8-15(9-3-12)25-19(27)17-13-4-5-14(7-6-13)18(17)20(25)28/h2-5,8-9,13-14,17-18H,6-7,10H2,1H3,(H,22,24,26) |
| InChIKey | FCPFKKHBRPQWKH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|