C14H11N5O2 — CID 66496100
11-(furan-2-ylmethyl)-8-methyl-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one (PubChem CID 66496100) has the molecular formula C14H11N5O2 and a molecular weight of 281.27 g/mol. Its IUPAC name is 11-(furan-2-ylmethyl)-8-methyl-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one.
| Compound Name | 11-(furan-2-ylmethyl)-8-methyl-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
|---|---|
| PubChem CID | 66496100 |
| Molecular Formula | C14H11N5O2 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 11-(furan-2-ylmethyl)-8-methyl-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
| SMILES | Cc1nc2ncnn2c2ccn(Cc3ccco3)c(=O)c12 |
| InChI | InChI=1S/C14H11N5O2/c1-9-12-11(19-14(17-9)15-8-16-19)4-5-18(13(12)20)7-10-3-2-6-21-10/h2-6,8H,7H2,1H3 |
| InChIKey | NIPITPWFDOXAJK-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 78.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |