C15H16N4O3 — CID 664968
7-methyl-4-propyl-5-(2H-tetrazol-5-ylmethoxy)chromen-2-one (PubChem CID 664968) has the molecular formula C15H16N4O3 and a molecular weight of 300.32 g/mol. Its IUPAC name is 7-methyl-4-propyl-5-(2H-tetrazol-5-ylmethoxy)chromen-2-one.
| Compound Name | 7-methyl-4-propyl-5-(2H-tetrazol-5-ylmethoxy)chromen-2-one |
|---|---|
| PubChem CID | 664968 |
| Molecular Formula | C15H16N4O3 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 7-methyl-4-propyl-5-(2H-tetrazol-5-ylmethoxy)chromen-2-one |
| SMILES | CCCc1cc(=O)oc2cc(C)cc(OCc3nn[nH]n3)c12 |
| InChI | InChI=1S/C15H16N4O3/c1-3-4-10-7-14(20)22-12-6-9(2)5-11(15(10)12)21-8-13-16-18-19-17-13/h5-7H,3-4,8H2,1-2H3,(H,16,17,18,19) |
| InChIKey | SLTJVFXKOMINPC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 93.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|