C18H17ClN4S — CID 66504618
N-(3-chloro-2-methylphenyl)-3,4-dihydro-2H-pyrimido[1,2-a]benzimidazole-1-carbothioamide (PubChem CID 66504618) has the molecular formula C18H17ClN4S and a molecular weight of 356.88 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-3,4-dihydro-2H-pyrimido[1,2-a]benzimidazole-1-carbothioamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-3,4-dihydro-2H-pyrimido[1,2-a]benzimidazole-1-carbothioamide |
|---|---|
| PubChem CID | 66504618 |
| Molecular Formula | C18H17ClN4S |
| Molecular Weight | 356.88 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-3,4-dihydro-2H-pyrimido[1,2-a]benzimidazole-1-carbothioamide |
| SMILES | Cc1c(Cl)cccc1NC(=S)N1CCCn2c1nc1ccccc12 |
| InChI | InChI=1S/C18H17ClN4S/c1-12-13(19)6-4-8-14(12)21-18(24)23-11-5-10-22-16-9-3-2-7-15(16)20-17(22)23/h2-4,6-9H,5,10-11H2,1H3,(H,21,24) |
| InChIKey | YBUJOAYGTVGIIX-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.88 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|