C16H13N7O2 — CID 66505604
N-(4-ethyl-10-oxo-2,3,5,7,8,11-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-11-yl)benzamide (PubChem CID 66505604) has the molecular formula C16H13N7O2 and a molecular weight of 335.33 g/mol. Its IUPAC name is N-(4-ethyl-10-oxo-2,3,5,7,8,11-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-11-yl)benzamide.
| Compound Name | N-(4-ethyl-10-oxo-2,3,5,7,8,11-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-11-yl)benzamide |
|---|---|
| PubChem CID | 66505604 |
| Molecular Formula | C16H13N7O2 |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | N-(4-ethyl-10-oxo-2,3,5,7,8,11-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-11-yl)benzamide |
| SMILES | CCc1nc2nnc3c(=O)n(NC(=O)c4ccccc4)ccc3n2n1 |
| InChI | InChI=1S/C16H13N7O2/c1-2-12-17-16-19-18-13-11(23(16)20-12)8-9-22(15(13)25)21-14(24)10-6-4-3-5-7-10/h3-9H,2H2,1H3,(H,21,24) |
| InChIKey | ADFAFLCBCRRRIT-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 107.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |