C13H11F3N2 — CID 66510300
(1S)-2,2,2-trifluoro-1-(4-pyridin-2-ylphenyl)ethanamine (PubChem CID 66510300) has the molecular formula C13H11F3N2 and a molecular weight of 252.24 g/mol. Its IUPAC name is (1S)-2,2,2-trifluoro-1-(4-pyridin-2-ylphenyl)ethanamine.
| Compound Name | (1S)-2,2,2-trifluoro-1-(4-pyridin-2-ylphenyl)ethanamine |
|---|---|
| PubChem CID | 66510300 |
| Molecular Formula | C13H11F3N2 |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | (1S)-2,2,2-trifluoro-1-(4-pyridin-2-ylphenyl)ethanamine |
| SMILES | N[C@@H](c1ccc(-c2ccccn2)cc1)C(F)(F)F |
| InChI | InChI=1S/C13H11F3N2/c14-13(15,16)12(17)10-6-4-9(5-7-10)11-3-1-2-8-18-11/h1-8,12H,17H2/t12-/m0/s1 |
| InChIKey | LFUGACBJKATHGN-LBPRGKRZSA-N |
| XLogP | 3.31 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |