C10H13ClN2O2 — CID 66518178
[3-chloro-4-[(1R)-1,2-diaminoethyl]phenyl] acetate (PubChem CID 66518178) has the molecular formula C10H13ClN2O2 and a molecular weight of 228.68 g/mol. Its IUPAC name is [3-chloro-4-[(1R)-1,2-diaminoethyl]phenyl] acetate.
| Compound Name | [3-chloro-4-[(1R)-1,2-diaminoethyl]phenyl] acetate |
|---|---|
| PubChem CID | 66518178 |
| Molecular Formula | C10H13ClN2O2 |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | [3-chloro-4-[(1R)-1,2-diaminoethyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc([C@@H](N)CN)c(Cl)c1 |
| InChI | InChI=1S/C10H13ClN2O2/c1-6(14)15-7-2-3-8(9(11)4-7)10(13)5-12/h2-4,10H,5,12-13H2,1H3/t10-/m0/s1 |
| InChIKey | NPASPZBJKOYQAO-JTQLQIEISA-N |
| XLogP | 1.22 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|