C8H14N4S — CID 66520381
5-(4-methylpiperazin-1-yl)-1,3-thiazol-2-amine (PubChem CID 66520381) has the molecular formula C8H14N4S and a molecular weight of 198.29 g/mol. Its IUPAC name is 5-(4-methylpiperazin-1-yl)-1,3-thiazol-2-amine.
| Compound Name | 5-(4-methylpiperazin-1-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 66520381 |
| Molecular Formula | C8H14N4S |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 5-(4-methylpiperazin-1-yl)-1,3-thiazol-2-amine |
| SMILES | CN1CCN(c2cnc(N)s2)CC1 |
| InChI | InChI=1S/C8H14N4S/c1-11-2-4-12(5-3-11)7-6-10-8(9)13-7/h6H,2-5H2,1H3,(H2,9,10) |
| InChIKey | AESNDTSWHZDHLU-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |