C25H24N4O7S — CID 66522782
methyl 4-[11-(4-methoxycarbonylphenyl)-2,4-dimethyl-1,3,5-trioxo-9-sulfanylidene-2,4,8,10-tetrazaspiro[5.5]undecan-7-yl]benzoate (PubChem CID 66522782) has the molecular formula C25H24N4O7S and a molecular weight of 524.56 g/mol. Its IUPAC name is methyl 4-[11-(4-methoxycarbonylphenyl)-2,4-dimethyl-1,3,5-trioxo-9-sulfanylidene-2,4,8,10-tetrazaspiro[5.5]undecan-7-yl]benzoate.
| Compound Name | methyl 4-[11-(4-methoxycarbonylphenyl)-2,4-dimethyl-1,3,5-trioxo-9-sulfanylidene-2,4,8,10-tetrazaspiro[5.5]undecan-7-yl]benzoate |
|---|---|
| PubChem CID | 66522782 |
| Molecular Formula | C25H24N4O7S |
| Molecular Weight | 524.56 g/mol |
| Exact Mass | 524.14 |
| IUPAC Name | methyl 4-[11-(4-methoxycarbonylphenyl)-2,4-dimethyl-1,3,5-trioxo-9-sulfanylidene-2,4,8,10-tetrazaspiro[5.5]undecan-7-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2NC(=S)NC(c3ccc(C(=O)OC)cc3)C23C(=O)N(C)C(=O)N(C)C3=O)cc1 |
| InChI | InChI=1S/C25H24N4O7S/c1-28-21(32)25(22(33)29(2)24(28)34)17(13-5-9-15(10-6-13)19(30)35-3)26-23(37)27-18(25)14-7-11-16(12-8-14)20(31)36-4/h5-12,17-18H,1-4H3,(H2,26,27,37) |
| InChIKey | XPAVLVHSPAHJPA-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 134.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.56 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|