C15H22BrNO4S — CID 66535750
2-[(2-bromo-4-ethoxy-5-methoxyphenyl)methylamino]-4-methylsulfanylbutanoic acid (PubChem CID 66535750) has the molecular formula C15H22BrNO4S and a molecular weight of 392.32 g/mol. Its IUPAC name is 2-[(2-bromo-4-ethoxy-5-methoxyphenyl)methylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[(2-bromo-4-ethoxy-5-methoxyphenyl)methylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 66535750 |
| Molecular Formula | C15H22BrNO4S |
| Molecular Weight | 392.32 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | 2-[(2-bromo-4-ethoxy-5-methoxyphenyl)methylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CCOc1cc(Br)c(CNC(CCSC)C(=O)O)cc1OC |
| InChI | InChI=1S/C15H22BrNO4S/c1-4-21-14-8-11(16)10(7-13(14)20-2)9-17-12(15(18)19)5-6-22-3/h7-8,12,17H,4-6,9H2,1-3H3,(H,18,19) |
| InChIKey | XKCAGZDLCOFNQH-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.32 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |