C25H26BrNO4 — CID 66544714
ethyl 4-[[2-bromo-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylamino]benzoate (PubChem CID 66544714) has the molecular formula C25H26BrNO4 and a molecular weight of 484.39 g/mol. Its IUPAC name is ethyl 4-[[2-bromo-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylamino]benzoate.
| Compound Name | ethyl 4-[[2-bromo-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylamino]benzoate |
|---|---|
| PubChem CID | 66544714 |
| Molecular Formula | C25H26BrNO4 |
| Molecular Weight | 484.39 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | ethyl 4-[[2-bromo-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NCc2cc(OC)c(OCc3ccc(C)cc3)cc2Br)cc1 |
| InChI | InChI=1S/C25H26BrNO4/c1-4-30-25(28)19-9-11-21(12-10-19)27-15-20-13-23(29-3)24(14-22(20)26)31-16-18-7-5-17(2)6-8-18/h5-14,27H,4,15-16H2,1-3H3 |
| InChIKey | HJDBTCHXCIOHOU-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.39 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |