C23H36N6O2S — CID 66546234
(4aR,6R,8aR)-2-amino-3-cyano-N-[3-(dimethylamino)propyl]-8-ethyl-N-(ethylcarbamoyl)-4a,5,6,7,8a,9-hexahydro-4H-thieno[3,2-g]quinoline-6-carboxamide (PubChem CID 66546234) has the molecular formula C23H36N6O2S and a molecular weight of 460.65 g/mol. Its IUPAC name is (4aR,6R,8aR)-2-amino-3-cyano-N-[3-(dimethylamino)propyl]-8-ethyl-N-(ethylcarbamoyl)-4a,5,6,7,8a,9-hexahydro-4H-thieno[3,2-g]quinoline-6-carboxamide.
| Compound Name | (4aR,6R,8aR)-2-amino-3-cyano-N-[3-(dimethylamino)propyl]-8-ethyl-N-(ethylcarbamoyl)-4a,5,6,7,8a,9-hexahydro-4H-thieno[3,2-g]quinoline-6-carboxamide |
|---|---|
| PubChem CID | 66546234 |
| Molecular Formula | C23H36N6O2S |
| Molecular Weight | 460.65 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | (4aR,6R,8aR)-2-amino-3-cyano-N-[3-(dimethylamino)propyl]-8-ethyl-N-(ethylcarbamoyl)-4a,5,6,7,8a,9-hexahydro-4H-thieno[3,2-g]quinoline-6-carboxamide |
| SMILES | CCNC(=O)N(CCCN(C)C)C(=O)[C@@H]1C[C@@H]2Cc3c(sc(N)c3C#N)C[C@H]2N(CC)C1 |
| InChI | InChI=1S/C23H36N6O2S/c1-5-26-23(31)29(9-7-8-27(3)4)22(30)16-10-15-11-17-18(13-24)21(25)32-20(17)12-19(15)28(6-2)14-16/h15-16,19H,5-12,14,25H2,1-4H3,(H,26,31)/t15-,16-,19-/m1/s1 |
| InChIKey | AEASDLAEYIHJRZ-GPMSIDNRSA-N |
| XLogP | 2.14 |
| TPSA | 105.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.65 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |