C21H22ClF2N5S — CID 66549132
3-[1-(2-chloro-3,5-difluorophenyl)ethylsulfanyl]-5-(1-piperidin-4-ylpyrazol-4-yl)pyridin-2-amine (PubChem CID 66549132) has the molecular formula C21H22ClF2N5S and a molecular weight of 449.96 g/mol. Its IUPAC name is 3-[1-(2-chloro-3,5-difluorophenyl)ethylsulfanyl]-5-(1-piperidin-4-ylpyrazol-4-yl)pyridin-2-amine.
| Compound Name | 3-[1-(2-chloro-3,5-difluorophenyl)ethylsulfanyl]-5-(1-piperidin-4-ylpyrazol-4-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 66549132 |
| Molecular Formula | C21H22ClF2N5S |
| Molecular Weight | 449.96 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | 3-[1-(2-chloro-3,5-difluorophenyl)ethylsulfanyl]-5-(1-piperidin-4-ylpyrazol-4-yl)pyridin-2-amine |
| SMILES | CC(Sc1cc(-c2cnn(C3CCNCC3)c2)cnc1N)c1cc(F)cc(F)c1Cl |
| InChI | InChI=1S/C21H22ClF2N5S/c1-12(17-7-15(23)8-18(24)20(17)22)30-19-6-13(9-27-21(19)25)14-10-28-29(11-14)16-2-4-26-5-3-16/h6-12,16,26H,2-5H2,1H3,(H2,25,27) |
| InChIKey | CYLGTDILLPBWGQ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.96 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|