C16H21NO7 — CID 66549468
(1R,3R,4S,5R)-1,3,4-trihydroxy-5-[3-(4-hydroxyphenyl)propanoylamino]cyclohexane-1-carboxylic acid (PubChem CID 66549468) has the molecular formula C16H21NO7 and a molecular weight of 339.34 g/mol. Its IUPAC name is (1R,3R,4S,5R)-1,3,4-trihydroxy-5-[3-(4-hydroxyphenyl)propanoylamino]cyclohexane-1-carboxylic acid.
| Compound Name | (1R,3R,4S,5R)-1,3,4-trihydroxy-5-[3-(4-hydroxyphenyl)propanoylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 66549468 |
| Molecular Formula | C16H21NO7 |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | (1R,3R,4S,5R)-1,3,4-trihydroxy-5-[3-(4-hydroxyphenyl)propanoylamino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(CCc1ccc(O)cc1)N[C@@H]1C[C@](O)(C(=O)O)C[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C16H21NO7/c18-10-4-1-9(2-5-10)3-6-13(20)17-11-7-16(24,15(22)23)8-12(19)14(11)21/h1-2,4-5,11-12,14,18-19,21,24H,3,6-8H2,(H,17,20)(H,22,23)/t11-,12-,14+,16-/m1/s1 |
| InChIKey | YOLHGJVODBDBJQ-UNIGVISCSA-N |
| XLogP | -0.86 |
| TPSA | 147.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |