C16H20O7 — CID 162926018
(1R,3R,4S,5R)-1,3,4-trihydroxy-5-[3-(4-hydroxyphenyl)prop-2-enoxy]cyclohexane-1-carboxylic acid (PubChem CID 162926018) has the molecular formula C16H20O7 and a molecular weight of 324.33 g/mol. Its IUPAC name is (1R,3R,4S,5R)-1,3,4-trihydroxy-5-[3-(4-hydroxyphenyl)prop-2-enoxy]cyclohexane-1-carboxylic acid.
| Compound Name | (1R,3R,4S,5R)-1,3,4-trihydroxy-5-[3-(4-hydroxyphenyl)prop-2-enoxy]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 162926018 |
| Molecular Formula | C16H20O7 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | (1R,3R,4S,5R)-1,3,4-trihydroxy-5-[3-(4-hydroxyphenyl)prop-2-enoxy]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)[C@@]1(O)C[C@@H](O)[C@H](O)[C@H](OCC=Cc2ccc(O)cc2)C1 |
| InChI | InChI=1S/C16H20O7/c17-11-5-3-10(4-6-11)2-1-7-23-13-9-16(22,15(20)21)8-12(18)14(13)19/h1-6,12-14,17-19,22H,7-9H2,(H,20,21)/t12-,13-,14+,16-/m1/s1 |
| InChIKey | MJRRVXXKDXXMHS-HGTKMLMNSA-N |
| XLogP | 0.12 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |