C20H27F2N5O6 — CID 66551192
(2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-N-[(3,4-difluorophenyl)methyl]-N-methyl-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 66551192) has the molecular formula C20H27F2N5O6 and a molecular weight of 471.46 g/mol. Its IUPAC name is (2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-N-[(3,4-difluorophenyl)methyl]-N-methyl-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-N-[(3,4-difluorophenyl)methyl]-N-methyl-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 66551192 |
| Molecular Formula | C20H27F2N5O6 |
| Molecular Weight | 471.46 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | (2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-N-[(3,4-difluorophenyl)methyl]-N-methyl-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | CC(=O)N[C@H]1[C@H]([C@H](O)[C@H](O)CO)OC(C(=O)N(C)Cc2ccc(F)c(F)c2)=C[C@@H]1N=C(N)N |
| InChI | InChI=1S/C20H27F2N5O6/c1-9(29)25-16-13(26-20(23)24)6-15(33-18(16)17(31)14(30)8-28)19(32)27(2)7-10-3-4-11(21)12(22)5-10/h3-6,13-14,16-18,28,30-31H,7-8H2,1-2H3,(H,25,29)(H4,23,24,26)/t13-,14+,16+,17+,18+/m0/s1 |
| InChIKey | RWTCHHVKNSOQGH-QBBQCFRVSA-N |
| XLogP | -1.93 |
| TPSA | 183.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.46 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|