C26H34O9 — CID 66552546
[(1S,3R,6S,8R,9S,10S,11S)-9,11-diacetyloxy-1-hydroxy-3,17,17-trimethyl-7-methylidene-2-oxo-15-oxatetracyclo[8.5.2.03,8.013,16]heptadec-13(16)-en-6-yl] acetate (PubChem CID 66552546) has the molecular formula C26H34O9 and a molecular weight of 490.55 g/mol. Its IUPAC name is [(1S,3R,6S,8R,9S,10S,11S)-9,11-diacetyloxy-1-hydroxy-3,17,17-trimethyl-7-methylidene-2-oxo-15-oxatetracyclo[8.5.2.03,8.013,16]heptadec-13(16)-en-6-yl] acetate.
| Compound Name | [(1S,3R,6S,8R,9S,10S,11S)-9,11-diacetyloxy-1-hydroxy-3,17,17-trimethyl-7-methylidene-2-oxo-15-oxatetracyclo[8.5.2.03,8.013,16]heptadec-13(16)-en-6-yl] acetate |
|---|---|
| PubChem CID | 66552546 |
| Molecular Formula | C26H34O9 |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | [(1S,3R,6S,8R,9S,10S,11S)-9,11-diacetyloxy-1-hydroxy-3,17,17-trimethyl-7-methylidene-2-oxo-15-oxatetracyclo[8.5.2.03,8.013,16]heptadec-13(16)-en-6-yl] acetate |
| SMILES | C=C1[C@@H](OC(C)=O)CC[C@@]2(C)C(=O)[C@@]3(O)OCC4=C3C(C)(C)[C@H]([C@@H](OC(C)=O)[C@H]12)[C@@H](OC(C)=O)C4 |
| InChI | InChI=1S/C26H34O9/c1-12-17(33-13(2)27)8-9-25(7)19(12)21(35-15(4)29)20-18(34-14(3)28)10-16-11-32-26(31,23(25)30)22(16)24(20,5)6/h17-21,31H,1,8-11H2,2-7H3/t17-,18-,19-,20-,21-,25+,26-/m0/s1 |
| InChIKey | NORKFFUVFFCEMF-VDNNVHGOSA-N |
| XLogP | 2.40 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|