C37H46O10 — CID 25151175
[(1S,2S,3S,5R,6R,8R,10S,14S)-2,5,10,14-tetraacetyloxy-8,12,15,15-tetramethyl-4-methylidene-6-tricyclo[9.3.1.03,8]pentadec-11-enyl] (E)-3-phenylprop-2-enoate (PubChem CID 25151175) has the molecular formula C37H46O10 and a molecular weight of 650.77 g/mol. Its IUPAC name is [(1S,2S,3S,5R,6R,8R,10S,14S)-2,5,10,14-tetraacetyloxy-8,12,15,15-tetramethyl-4-methylidene-6-tricyclo[9.3.1.03,8]pentadec-11-enyl] (E)-3-phenylprop-2-enoate.
| Compound Name | [(1S,2S,3S,5R,6R,8R,10S,14S)-2,5,10,14-tetraacetyloxy-8,12,15,15-tetramethyl-4-methylidene-6-tricyclo[9.3.1.03,8]pentadec-11-enyl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 25151175 |
| Molecular Formula | C37H46O10 |
| Molecular Weight | 650.77 g/mol |
| Exact Mass | 650.31 |
| IUPAC Name | [(1S,2S,3S,5R,6R,8R,10S,14S)-2,5,10,14-tetraacetyloxy-8,12,15,15-tetramethyl-4-methylidene-6-tricyclo[9.3.1.03,8]pentadec-11-enyl] (E)-3-phenylprop-2-enoate |
| SMILES | C=C1[C@@H](OC(C)=O)[C@H](OC(=O)/C=C/c2ccccc2)C[C@@]2(C)C[C@H](OC(C)=O)C3=C(C)C[C@H](OC(C)=O)[C@@H]([C@@H](OC(C)=O)[C@H]12)C3(C)C |
| InChI | InChI=1S/C37H46O10/c1-20-17-27(43-22(3)38)33-35(46-25(6)41)32-21(2)34(45-24(5)40)29(47-30(42)16-15-26-13-11-10-12-14-26)19-37(32,9)18-28(44-23(4)39)31(20)36(33,7)8/h10-16,27-29,32-35H,2,17-19H2,1,3-9H3/b16-15+/t27-,28-,29+,32-,33-,34+,35-,37+/m0/s1 |
| InChIKey | QTWVQHVPAKTARP-YTRUBSFUSA-N |
| XLogP | 5.69 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.77 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|