C15H20BrFN2O3 — CID 66552763
ethyl (2R)-2-(5-bromo-2-fluorophenyl)-3-(tert-butyldiazenyl)-2-hydroxypropanoate (PubChem CID 66552763) has the molecular formula C15H20BrFN2O3 and a molecular weight of 375.24 g/mol. Its IUPAC name is ethyl (2R)-2-(5-bromo-2-fluorophenyl)-3-(tert-butyldiazenyl)-2-hydroxypropanoate.
| Compound Name | ethyl (2R)-2-(5-bromo-2-fluorophenyl)-3-(tert-butyldiazenyl)-2-hydroxypropanoate |
|---|---|
| PubChem CID | 66552763 |
| Molecular Formula | C15H20BrFN2O3 |
| Molecular Weight | 375.24 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | ethyl (2R)-2-(5-bromo-2-fluorophenyl)-3-(tert-butyldiazenyl)-2-hydroxypropanoate |
| SMILES | CCOC(=O)[C@](O)(C/N=N/C(C)(C)C)c1cc(Br)ccc1F |
| InChI | InChI=1S/C15H20BrFN2O3/c1-5-22-13(20)15(21,9-18-19-14(2,3)4)11-8-10(16)6-7-12(11)17/h6-8,21H,5,9H2,1-4H3/b19-18+/t15-/m0/s1 |
| InChIKey | YGSIINAFEJUSBY-MJWGMMHASA-N |
| XLogP | 3.59 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.24 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|