C10H15NO — CID 66554168
6-methoxy-1,2,3,4,5,8-hexahydroisoquinoline (PubChem CID 66554168) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is 6-methoxy-1,2,3,4,5,8-hexahydroisoquinoline.
| Compound Name | 6-methoxy-1,2,3,4,5,8-hexahydroisoquinoline |
|---|---|
| PubChem CID | 66554168 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 6-methoxy-1,2,3,4,5,8-hexahydroisoquinoline |
| SMILES | COC1=CCC2=C(CCNC2)C1 |
| InChI | InChI=1S/C10H15NO/c1-12-10-3-2-9-7-11-5-4-8(9)6-10/h3,11H,2,4-7H2,1H3 |
| InChIKey | ZEYFJYGPHZFYQU-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|