C41H46O9 — CID 66554617
(2R,3R,6S)-6-[(2R,3R,4S,5R,6S)-6-methoxy-4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxan-3-yl]oxy-2-(phenylmethoxymethyl)-3,6-dihydro-2H-pyran-3-ol (PubChem CID 66554617) has the molecular formula C41H46O9 and a molecular weight of 682.81 g/mol. Its IUPAC name is (2R,3R,6S)-6-[(2R,3R,4S,5R,6S)-6-methoxy-4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxan-3-yl]oxy-2-(phenylmethoxymethyl)-3,6-dihydro-2H-pyran-3-ol.
| Compound Name | (2R,3R,6S)-6-[(2R,3R,4S,5R,6S)-6-methoxy-4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxan-3-yl]oxy-2-(phenylmethoxymethyl)-3,6-dihydro-2H-pyran-3-ol |
|---|---|
| PubChem CID | 66554617 |
| Molecular Formula | C41H46O9 |
| Molecular Weight | 682.81 g/mol |
| Exact Mass | 682.31 |
| IUPAC Name | (2R,3R,6S)-6-[(2R,3R,4S,5R,6S)-6-methoxy-4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxan-3-yl]oxy-2-(phenylmethoxymethyl)-3,6-dihydro-2H-pyran-3-ol |
| SMILES | CO[C@H]1O[C@H](COCc2ccccc2)[C@@H](O[C@H]2C=C[C@@H](O)[C@@H](COCc3ccccc3)O2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C41H46O9/c1-43-41-40(47-27-33-20-12-5-13-21-33)39(46-26-32-18-10-4-11-19-32)38(36(49-41)29-45-25-31-16-8-3-9-17-31)50-37-23-22-34(42)35(48-37)28-44-24-30-14-6-2-7-15-30/h2-23,34-42H,24-29H2,1H3/t34-,35-,36-,37+,38-,39+,40-,41+/m1/s1 |
| InChIKey | AXZHZVNFZXXOCW-BELHCJFVSA-N |
| XLogP | 5.99 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.81 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|